GJ103 sodium salt
GJ103 sodium salt is an active analog of GJ072, a read-through compound. It has been shown to reduce the surface tension of aqueous solutions, which makes it easier for molecules to move through the solution. It has also been shown to reduce the viscosity of aqueous solutions, which makes it easier for molecules to move through the solution. Additionally, it has been shown to reduce the pH of aqueous solutions, which can have a variety of effects on the biochemical and physiological processes of living organisms.
| Catalog Number | T4251 |
| Research Area | DNA Damage/DNA Repair|||PI3K/Akt/mTOR signaling |
| Molecular Formula | C16H13N4NaO3S |
| CAS# | 1459687-96-7 |
| Purity | 99.72% |
| SMILES | [Na+].COc1cccc(c1)-n1c(SCC([O-])=O)nnc1-c1ccccn1 |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/GJ103 sodium salt |
| Additional Information | https://www.targetmol.com/datasheet/T4251 |
