CGP 52411
CGP 52411 inhibited the EGF-R protein-tyrosine kinase in vitro with high selectivity. In cells, CGP52411 selectively inhibited both ligand-induced EGF-R and p185c-erbB2 autophosphorylation and c-fos mRNA induction.
| Trivial name | / |
| Catalog Number | CSN25283 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C20H15N3O2 |
| CAS# | 145915-58-8 |
| Purity | ≥98% |
| SMILES | O=C(N1)C2=CC(NC3=CC=CC=C3)=C(NC4=CC=CC=C4)C=C2C1=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/cgp 52411.html |