Tiagabine HCl
Tiagabine HCl is an inhibitor of gamma-aminobutyric acid (GABA) reuptake (IC50 = 67 nM in vivo) with anticonvulsant effect.
| Trivial name | NO050328 HCl; NO-328 HCl; TGB HCl |
| Catalog Number | CSN12085 |
| Alternative Name(s) | NO050328 HCl; NO-328 HCl; TGB HCl |
| Research Area | Neurological Disease |
| Molecular Formula | C20H26ClNO2S2 |
| CAS# | 145821-59-6 |
| Purity | ≥99% |
| SMILES | O=C([C@H]1CN(CC/C=C(C2=C(C)C=CS2)/C3=C(C)C=CS3)CCC1)O.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/tiagabine-hcl.html |
