G-749 10mM * 1mL in DMSO
G-749 is a novel and potent FLT3 inhibitor with IC50 of 0.4 nM, 0.6 nM and 1 nM for FLT3 (WT), FLT3 (D835Y).
| Trivial name | G-749 10mM * 1mL in DMSO |
| Catalog Number | A14214-10mM-D |
| Alternative Name(s) | 8-bromo-2-[(1-methyl-4-piperidinyl)amino]-4-[(4-phenoxyphenyl)amino]-pyrido[4,3-d]pyrimidin-5(6H)-one |
| Molecular Formula | C25H25BrN6O2 |
| CAS# | 1457983-28-6 |
| SMILES | CN1CCC(CC1)NC2=NC3=C(C(=O)NC=C3Br)C(=N2)NC4=CC=C(C=C4)OC5=CC=CC=C5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/g-749.html |
