Kadsurenin B | MedChemExpress (MCE)

Kadsurenin B is a PAF (platelet-activating factor) antagonist with neuroprotective activity. Kadsurenin B has a wide range of pharmacological research potential, such as antibacterial, anti-inflammatory, neuroprotective, antioxidant, antiplatelet aggregation, cytotoxic, antiparasitic, etc[1][2].

Trivial name Kadsurenin B
Catalog Number HY-N11920
Research Area Neurological Disease; Inflammation/Immunology; Infection
CAS# 145701-13-9
Purity ≥98.00%
SMILES CO[C@@]([C@@H]1O)(C=C2CC=C)[C@@H]([C@@H](C3=CC=C4C(OCO4)=C3)[C@]1([H])C2=O)C
PubChem Chemical Structure ID 162937219
Size 1 mg
Supplier Page https://www.medchemexpress.com/kadsurenin-b.html