Kadsurenin B | MedChemExpress (MCE)
Kadsurenin B is a PAF (platelet-activating factor) antagonist with neuroprotective activity. Kadsurenin B has a wide range of pharmacological research potential, such as antibacterial, anti-inflammatory, neuroprotective, antioxidant, antiplatelet aggregation, cytotoxic, antiparasitic, etc[1][2].
Trivial name | Kadsurenin B |
Catalog Number | HY-N11920 |
Research Area | Neurological Disease; Inflammation/Immunology; Infection |
CAS# | 145701-13-9 |
Purity | ≥98.00% |
SMILES | CO[C@@]([C@@H]1O)(C=C2CC=C)[C@@H]([C@@H](C3=CC=C4C(OCO4)=C3)[C@]1([H])C2=O)C |
PubChem Chemical Structure ID | 162937219 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/kadsurenin-b.html |