PF-06463922 10mM * 1mL in DMSO
PF-06463922 is a potent, dual ALK/ROS1 inhibitor with Ki of <0.02 nM, <0.07 nM, and 0.7 nM for ROS1, ALK (WT), and ALK (L1196M), respectively.
| Trivial name | PF-06463922 10mM * 1mL in DMSO |
| Catalog Number | A14207-10mM-D |
| Alternative Name(s) | (10R)-7-amino-12-fluoro-10,15,16,17-tetrahydro-2,10,16-trimethyl-15-oxo-2H-4,8-methenopyrazolo[4,3-h][2,5,11]benzoxadiazacyclotetradecine-3-carbonitrile |
| Molecular Formula | C21H19FN6O2 |
| CAS# | 1454846-35-5 |
| SMILES | C[C@@H]1C2=C(C=CC(=C2)F)C(=O)N(CC3=NN(C(=C3C4=CC(=C(N=C4)N)O1)C#N)C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pf-06463922.html |