Isochlorogenic Acid B
3,4-Dicaffeoylquinic Acid is a polyphenol with diverse biological activities, it inhibits acetylcholinesterase (ACE) and α-glucosidase in a concentration-dependent manner, shows cytotoxic to NCI-H23 lung adenocarcinoma cells, as well as increases tumor necrosis factor-related apoptosis inducing ligand (TRAIL) mRNA, reduces influenza H1N1 hemagglutinin (HA) mRNA and increases survival in a mouse model of influenza A infection.
| Trivial name | 3,4-Dicaffeoylquinic Acid |
| Catalog Number | CSN19329 |
| Alternative Name(s) | 3,4-Dicaffeoylquinic Acid |
| Research Area | / |
| Molecular Formula | C25H24O12 |
| CAS# | 14534-61-3 |
| Purity | ≥98% |
| SMILES | O=C([C@@]1(O)C[C@@H](OC(/C=C/C2=CC=C(O)C(O)=C2)=O)[C@H](OC(/C=C/C3=CC=C(O)C(O)=C3)=O)[C@H](O)C1)O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/isochlorogenic-acid-b.html |
