Dexmedetomidine HCl 10mM * 1mL in DMSO
Dexmedetomidine hydrochloride is the active isomer of medetomide which acts a potent, highly selective ??2-AR (??2-adrenoceptor) agonist.
| Trivial name | Dexmedetomidine HCl 10mM * 1mL in DMSO |
| Catalog Number | A11846-10mM-D |
| Alternative Name(s) | 4-[(1S)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride |
| Molecular Formula | C13H16N2.HCl |
| CAS# | 145108-58-3 |
| SMILES | CC1=C(C(=CC=C1)[C@H](C)C2=CN=CN2)C.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dexmedetomidine-hcl.html |
