Kinetin triphosphate | MedChemExpress (MCE)
Kinetin triphosphate(6-Fu-ATP; KTP) is an ATP analogue that regulates or enhances kinase function with higher catalytic efficiency than its endogenous substrate, ATP. Kinetin triphosphate can be used in Parkinson’s disease research[1].
| Trivial name | Kinetin triphosphate |
| Catalog Number | HY-134398 |
| Alternative Name(s) | 6-Fu-ATP; KTP |
| Research Area | Neurological Disease |
| CAS# | 1450894-16-2 |
| Purity | ≥98.00% |
| SMILES | O=P(O)(O)OP(OP(OC[C@H]1O[C@@H](N2C3=NC=NC(NCC4=CC=CO4)=C3N=C2)[C@H](O)[C@@H]1O)(O)=O)(O)=O |
| PubChem Chemical Structure ID | 166642628 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kinetin-triphosphate.html |