YM 022
CCK2 silent antagonist GPCR/G protein|CCK2 Receptors
| Catalog Number | B6725-10 |
| Research Area | GPCR/G protein|CCK2 Receptors |
| Molecular Formula | C32H28N4O3 |
| CAS# | 145084-28-2 |
| Purity | 98% |
| SMILES | O=C1N(CC(C2=CC=CC=C2C)=O)C3=CC=CC=C3C(C4=CC=CC=C4)=N[C@H]1NC(NC5=CC=CC(C)=C5)=O |
| Size | 10mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6725 |
