α-Naphtholbenzein | MedChemExpress (MCE)
α-Naphtholbenzein (p-Naphtolbenzein) is a dye. α-Naphtholbenzein can be used as a pH indicator. α-Naphtholbenzein has a visual transition from yellow (pH0-8.2) to turquoise (pH10). α-Naphtholbenzein is often used during sequential injection analysis technique done for acid-base titrations[1].
| Trivial name | α-Naphtholbenzein |
| Catalog Number | HY-125457 |
| Alternative Name(s) | p-Naphtolbenzein |
| Research Area | Others |
| CAS# | 145-50-6 |
| Purity | ≥98.00% |
| SMILES | O=C1C=C/C(C2=C1C=CC=C2)=C(C3=C4C=CC=CC4=C(O)C=C3)/C5=CC=CC=C5 |
| PubChem Chemical Structure ID | 5941340 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-naphtholbenzein.html |