Taurocholic acid sodium salt
Taurocholic acid sodium salt (Sodium Taurocholate, TANa) is a sodium salt of taurocholic acid and occurs in the bile of mammals. Taurocholic acid is used as a cholagogue and choleretic.
| Trivial name | Sodium Taurocholate, TANa |
| Catalog Number | E0154 |
| Molecular Formula | C26H45NO7S.Na |
| CAS# | 145-42-6 |
| SMILES | [Na+].CC(CCC(=O)NCC[S]([O-])(=O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/taurocholic-acid-sodium-salt.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0154-sodium-taurocholate-chemical-structure.gif |