Pregnenolone 10mM * 1mL in DMSO
Pregnenolone is an endogenous steroid hormone for inhibition of M1 receptor- and M3 receptor-mediated currents with IC5N/A of 11.4 ?M and 6.N/A ?M, respectively.
Trivial name | Pregnenolone 10mM * 1mL in DMSO |
Catalog Number | A11909-10mM-D |
Alternative Name(s) | 3b-Hydroxy-5-pregnen-20-one |
Molecular Formula | C21H32O2 |
CAS# | 145-13-1 |
SMILES | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/pregnenolone.html |