K145 HCl
K145 HCl is a selective SphK2 inhibitor with an IC50 of 4.30±0.06 μM , while no inhibition of SphK1 at concentrations up to 10 μM.
| Trivial name | SphK2 Inhibitor HCl |
| Catalog Number | CSN17876 |
| Alternative Name(s) | SphK2 Inhibitor HCl |
| Research Area | Cancer |
| Molecular Formula | C18H25ClN2O3S |
| CAS# | 1449240-68-9 |
| Purity | ≥99% |
| SMILES | O=C(N(CCN)C/1=O)SC1=C/CCC2=CC=C(OCCCC)C=C2.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/k145-hcl.html |
