AZD-3965 5mg
AZD3965 is a selective inhibitor of monocarboxylate transporter 1 (MCT1) with a binding affinity of 1.6 nM, is 6 fold selective over MCT2 and does not inhibit MCT4 at 10 ??M.
| Trivial name | AZD-3965 5mg |
| Catalog Number | A14186-5 |
| Alternative Name(s) | (S)-5-(4-hydroxy-4-methylisoxazolidine-2-carbonyl)-1-isopropyl-3-methyl-6-((3-methyl-5-(trifluoromethyl)-1H-pyrazol-4-yl)methyl)thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione |
| Molecular Formula | C21H24F3N5O5S |
| CAS# | 1448671-31-5 |
| SMILES | O=C1N(C(C)C)C2=C(C(C(N3OC[C@@](C)(O)C3)=O)=C(CC4=C(C(F)(F)F)NN=C4C)S2)C(N1C)=O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/azd-3965.html |
