ZJ-101 | MedChemExpress (MCE)
ZJ-101 is a structurally simplified analog derived from the marine natural product superstolide A. ZJ-101 exhibits potent antiproliferative activity. ZJ-101 can target and inhibit O-glycosylation, thereby modulating the endomembrane system. ZJ-101 can inhibit cell-cell adhesion[1].
| Trivial name | ZJ-101 |
| Catalog Number | HY-161424 |
| Research Area | Cancer |
| CAS# | 1448446-23-8 |
| Purity | ≥98.0% |
| SMILES | C[C@@]1(/C=C/C(C)=C\C=C\2)CCC=C[C@@H]1/C=C(C)/C=C/[C@@H](C)[C@H]([C@H](C)[C@H](O)[C@@H](C)NC(C)=O)OC2=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zj-101.html |