Olmesartan medoxomil 200mg
Olmesartan medoxomil is an angiotensin II receptor antagonist used to treat high blood pressure. Olmesartan works by blocking the binding of angiotensin II to the AT1 receptors in vascular muscle. By blocking the binding rather than the synthesis of angiotensin II, olmesartan inhibits the negative regulatory feedback on renin secretion.
| Trivial name | Olmesartan medoxomil 200mg |
| Catalog Number | A11615-200 |
| Alternative Name(s) | (5-methyl-2-oxo-2H-1,3-dioxol-4-yl)methyl 4-(2-hydroxypropan-2-yl)-2-propyl-1-({4-[2-(2H-1,2,3,4-tetrazol-5-yl)phenyl]phenyl}methyl)-1H-imidazole-5-carboxylate |
| Molecular Formula | C29H30N6O6 |
| CAS# | 144689-63-4 |
| SMILES | CCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NNN=N4)C(=O)OCC5=C(OC(=O)O5)C)C(C)(C)O |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/olmesartan-medoxomil.html |
