RO9021
Syk inhibitor Tyrosine Kinase|Spleen Tyrosine Kinase (Syk)
| Catalog Number | B6158-1 |
| Research Area | Tyrosine Kinase|Spleen Tyrosine Kinase (Syk) |
| Molecular Formula | C18H25N7O |
| CAS# | 1446790-62-0 |
| Purity | 98% |
| SMILES | O=C(C1=NN=C(N[C@H]2[C@@H](N)CCCC2)C=C1NC3=NC(C)=C(C)C=C3)N |
| Size | 1mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6158 |
