9-Propenyladenine (Standard) | MedChemExpress (MCE)
9-Propenyladenine (Standard) is the analytical standard of 9-Propenyladenine. This product is intended for research and analytical applications. 9-Propenyladenine is a mutagenic impurity in tenofovir disoproxil fumarate. Tenofovir is an antiretroviral agent known as nucleotide analogue reverse transcriptase inhibitors, which block reverse transcriptase, a crucial virus enzyme in HIV-1 and HBV.
| Trivial name | 9-Propenyladenine (Standard) |
| Catalog Number | HY-100079R |
| Alternative Name(s) | Mutagenic Impurity of Tenofovir Disoproxil (Standard); Tenofovir Impurity 2 (Standard) |
| Research Area | Infection |
| CAS# | 1446486-33-4 |
| Purity | ≥98.0% |
| SMILES | NC1=C2N=CN(/C=C/C)C2=NC=N1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/9-propenyladenine-standard.html |