8,12-iso-iPF2α-VI | MedChemExpress (MCE)
8,12-iso-iPF2α-VI is a F2-isoprostanes. 8,12-iso-iPF2α-VI is a sensitive and specific marker of in vivo lipid peroxidation. 8,12-iso-iPF2α-VI can be used as a biomarker of oxidative damage in alzheimer’s disease[1].
| Trivial name | 8,12-iso-iPF2α-VI |
| Catalog Number | HY-137119A |
| Research Area | Others |
| CAS# | 1445349-99-4 |
| Purity | ≥98.0% |
| SMILES | OC(CCCC(O)/C=C/[C@@H]1[C@@H]([C@@H](C[C@@H]1O)O)C/C=C\CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/8-12-iso-ipf2α-vi.html |