Empesertib (BAY1161909)
Empesertib (BAY1161909, Mps1-IN-5), a derivative of triazolopyridine, is an orally bioavailable, selective inhibitor of the serine/threonine monopolar spindle 1 (Mps1) kinase with IC50 of <1 nM. Empesertib has potential antineoplastic activity.
| Trivial name | Mps1-IN-5 |
| Catalog Number | S8214 |
| Molecular Formula | C29H26FN5O4S |
| CAS# | 1443763-60-7 |
| SMILES | CC(C1=CC=C(C=C1)F)C(=O)NC2=CC=C(C=C2)C3=CN4C(=NC(=N4)NC5=C(C=C(C=C5)S(=O)(=O)C)OC)C=C3 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/bay-1161909.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s8214-empesertib-chemical-structure.gif |