Enzalutamide D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10805 |
| Alternative Name(s) | 4-{3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5- bis(D3)methyl-4-oxo-2-sulfanylideneimidazolidin-1- yl}-2-fluoro-N-methylbenzamide |
| Research Area | Labeled Enzalutamide, intended for use as an internal standard for the quantification of Enzalutamide by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H10D6F4N4O2S |
| CAS# | 1443331-94-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | S=C(N1C2=CC(C(F)(F)F)=C(C#N)C=C2)N(C3=CC(F)=C(C(NC)=O)C=C3)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10805.html |
| Additional Information | NULL |