alpha-D-glucose hydrate | MedChemExpress (MCE)
alpha-D-glucose hydrate is a monosaccharide and the most common form of glucose. It is a monosaccharide, which means it cannot be broken down into simpler sugars. alpha-D-glucose plays a vital role in energy metabolism and is the primary source of energy for many cells in the body. It is also a building block of larger carbohydrates such as starch and glycogen. The “α” prefix refers to the orientation of the hydroxyl group attached to the first carbon atom. Alpha-D-glucose exists in solution as a hydrate, which means it is bound to water molecules.
| Trivial name | alpha-D-glucose hydrate |
| Catalog Number | HY-128417A |
| Research Area | Others |
| CAS# | 14431-43-7 |
| Purity | ≥98.0% |
| SMILES | OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O.O |
| Size | 50 g |
| Supplier Page | https://www.medchemexpress.com/alpha-d-glucose-hydrate.html |
