Kadsulignan H | MedChemExpress (MCE)
Kadsulignan H (compound 13) is a lignan with inhibitory activity on NO production. Kadsulignan H inhibits NO production in BV-2 cells with an IC50 of 14.1 μM[1].
| Trivial name | Kadsulignan H |
| Catalog Number | HY-N11943 |
| Research Area | Others |
| CAS# | 144049-91-2 |
| Purity | ≥98.00% |
| SMILES | C[C@@H]1CC2=C3(C(=C(OC)C(OC)=C2)=O)C4=C(C=C(OCO5)C5=C4OC3)[C@H](OC(CCC)=O)[C@@H]1C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kadsulignan-h.html |