(S)-Stiripentol
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-31034 |
| Alternative Name(s) | (S)-Stiripentol;(-)-Stiripentol;[S-(E)]-1-(1,3-Benzodioxol-5-yl)-4,4-dimethyl-1-penten-3-ol - ;(1E,3S)-1-(2H-1,3-benzodioxol-5-yl)-4,4- dimethylpent-1-en-3-ol |
| Research Area | (S)-Stiripentol is an S-isomer of Stiripentol which is an epilepsy drug. It has been used as co-therapy for treatment of epilepsy. It inhibits the enzymes responsible for metabolism of other anti-convulsant agents. |
| Molecular Formula | C14H18O3 |
| CAS# | 144017-66-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H](C(C)(C)C)/C=C/C1=CC(OCO2)=C2C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31034.html |
| Additional Information | NULL |