R-Stiripentol D9
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11068 |
| Alternative Name(s) | (1E,3R)-1-(2H-1,3-benzodioxol-5-yl)-4,4-bis(D3)methyl(5,5,5-D3)pent-1-en-3-ol |
| Research Area | Labeled Stiripentol, intended for use as an internal standard for the quantification of Stiripentol by GC- or LC-mass spectrometry. |
| Molecular Formula | C14H9D9O3 |
| CAS# | 144017-65-2(Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])/C=C/C1=CC(OCO2)=C2C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11068.html |
| Additional Information | NULL |