Sulfamethizole
Marine
| Trivial name | NULL |
| Catalog Number | CS-T-42779 |
| Alternative Name(s) | 2-Methyl-5-sulfanilamido-1,3,4-thiadiazole |
| Research Area | Sulfamethizole is a sulfonamide based antibiotic that exhibit bactericidal activities towards gram-negative bacteria. Sulfamehizole was shown to be effective in treating gram-negative Bacillus AmpC enzyme in elderly patients with lower respiratory tract infection and as well as against microbs responsible for tuberculosis. |
| Molecular Formula | C9H10N4O2S2 |
| CAS# | 144-82-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](NC1=NN=C(C)S1)(C2=CC=C(N)C=C2)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST42779.html |
| Additional Information | NULL |