Sulfacetamide (Standard) | MedChemExpress (MCE)
Sulfacetamide (Standard) is the analytical standard of Sulfacetamide. This product is intended for research and analytical applications. Sulfacetamide (Sulphacetamide), a bacteriostatic sulphonamide, is a popular antibiotic prescribed for treating ocular infections[1][2].
| Trivial name | Sulfacetamide (Standard) |
| Catalog Number | HY-N7123R |
| Alternative Name(s) | Sulphacetamide (Standard) |
| Research Area | Infection |
| CAS# | 144-80-9 |
| Purity | ≥98.0% |
| SMILES | CC(NS(=O)(C1=CC=C(N)C=C1)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/sulfacetamide-standard.html |