Elacridar hydrochloride
Elacridar hydrochloride (GF120918A) is an orally active P-glycoprotein (P-gp) and breast cancer resistance protein (BCRP) inhibitor. Elacridar hydrochloride can be used to examine the influence of efflux transporters on agent distribution to brain and it can be used for the research of cancer.
| Trivial name | GF120918A |
| Catalog Number | E7515 |
| Molecular Formula | C12H8O4 |
| CAS# | 143851-98-3 |
| Inchi | InChI=1S/C12H8O4/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12/h2-6H,1H3 |
| Inchi Key | QXKHYNVANLEOEG-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/elacridar-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7515-elacridar-hydrochloride-chemical-structure-tube.png |
