Piperidine D11
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-15208 |
| Alternative Name(s) | (1,2,2,3,3,4,4,5,5,6,6-D11) piperidine;(D11)piperidine. |
| Research Area | Labeled piperidine, intended for use as an internal standard for the quantification of piperidine by GC- or LC-mass spectrometry. |
| Molecular Formula | C5D11N |
| CAS# | 143317-90-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])N([2H])C([2H])([2H])C1([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15208.html |
| Additional Information | NULL |