Zinc dethyldithiocarbamate | MedChemExpress (MCE)
Zinc Diethyldithiocarbamate is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Trivial name | Zinc dethyldithiocarbamate |
| Catalog Number | HY-101505 |
| Alternative Name(s) | Ethyl ziram |
| Research Area | Others |
| CAS# | 14324-55-1 |
| Purity | 99.74% |
| SMILES | CCN(CC)C([S-]1)=[S][Zn+2]21[S-]C(N(CC)CC)=[S]2 |
| Size | 25 g |
| Supplier Page | https://www.medchemexpress.com/zinc-diethyldithiocarbamate.html |