(-)-Lyoniresinol 9′-O-glucoside | MedChemExpress (MCE)
(-)-Lyoniresinol 9′-O-glucoside is an inhibitor of ROS. (-)-Lyoniresinol 9′-O-glucoside reduces lipid accumulation and lipid metabolic disorders in FFAs-exposed HepG2 cells. (-)-Lyoniresinol 9′-O-glucoside inhibits high glucose-induced reactive oxygen species production[1].
| Trivial name | (-)-Lyoniresinol 9'-O-glucoside |
| Catalog Number | HY-N8466 |
| Research Area | Metabolic Disease |
| CAS# | 143236-02-6 |
| Purity | ≥98.00% |
| SMILES | COC1=C(C(C2)=CC(OC)=C1O)[C@@H](C(C=C3OC)=CC(OC)=C3O)[C@@H]([C@H]2CO)CO[C@@H]([C@@H]([C@H]4O)O)O[C@@H]([C@H]4O)CO |
| PubChem Chemical Structure ID | 10031185 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/minus-lyoniresinol-9-o-glucoside.html |