AT7519 trifluoroacetate 10mg
AT7519 trifluoroacetate is a multi-CDK inhibitor for CDK1, 2, 4, 6 and 9 with IC50 of 10-210 nM, less potent to CDK3 and little active to CDK7.
| Trivial name | AT7519 trifluoroacetate 10mg |
| Catalog Number | A15005-10 |
| Alternative Name(s) | 4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-yl-1H-pyrazole-5-carboxamide,2,2,2-trifluoroacetic acid |
| Molecular Formula | C18H18Cl2F3N5O4 |
| CAS# | 1431697-85-6 |
| SMILES | C1CNCCC1NC(=O)C2=C(C=NN2)NC(=O)C3=C(C=CC=C3Cl)Cl.C(=O)(C(F)(F)F)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/at7519-trifluoroacetate.html |
