UWA-101 hydrochloride | MedChemExpress (MCE)
UWA-101 hydrochloride is a selective and non-cytotoxic DAT/SERT inhibitor, with EC50 values of 3.6 µM and 2.3 µM for inhibiting DAT and SERT, respectively. UWA-101 hydrochloride can alleviate the side effects of dopaminergic agents (such as L-DOPA), such as motor disorders, and lacks psychotropic activity. UWA-101 hydrochloride can be used for research on neurodegenerative diseases such as Parkinson’s disease[1][2].
| Trivial name | UWA-101 hydrochloride | 
| Catalog Number | HY-117512 | 
| Research Area | Neurological Disease | 
| CAS# | 1431520-52-3 | 
| Purity | ≥98.0% | 
| SMILES | CNC(C1CC1)CC2=CC=C3OCOC3=C2.Cl | 
| Size | 1 mg | 
| Supplier Page | https://www.medchemexpress.com/uwa-101-hydrochloride.html | 
                    