Vinblastine 13C D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-CX-00552 |
| Alternative Name(s) | methyl (1R,9R,10S,11R,12R,19R)‐11‐[(1‐13C,D3)acetyloxy]‐12‐ethyl‐4‐[(13S,15S,17S)‐17‐ethyl‐17‐hydroxy‐13‐(methoxycarbonyl)‐1,11‐diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5(10),6,8‐tetraen‐13‐yl]‐10‐hydroxy‐5‐methoxy‐8‐methyl‐8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13‐tetraene‐10‐carboxylate |
| Research Area | Labeled Vinblastine, intended for use as an internal standard for the quantification of Vinblastine by GC- or LC-mass spectrometry. |
| Molecular Formula | C45[13C]H55D3N4O9 |
| CAS# | 143-67-9 (Unlabeled) (Free base) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC[C@@]1(C=CCN2CC3)[C@@]2([H])[C@@]3(C4=CC([C@](C5=C6C7=CC=CC=C7N5)(C[C@](C[C@](CC)(O)C8)([H])C[N@@]8CC6)C(OC)=O)=C(OC)C=C4N9C)[C@]9([H])[C@](C(OC)=O)(O)[C@@H]1O[13C](C([2H])([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSCX00552.html |
| Additional Information | NULL |