Vinblastine Sulfate
Vinblastine Sulfate is the sulfate salt of vinblastine, a natural alkaloid isolated from the plant Catharanthus roseus (Madagascar periwinkle) with antineoplastic properties. Vinblastine disrupts microtubule formation and function during mitosis and interferes with glutamic acid metabolism.
| Catalog Number | PIPE-0715 |
| Alternative Name(s) | Velsar Velban Velbe |
| Research Area | Natural Extract |
| Molecular Formula | C46H58N4O9.H2O4S |
| CAS# | 143-67-9 |
| SMILES | CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O.OS(=O)(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/vinblastine-sulfate-item-9654.html |