Xipamide
Xipamide, a sulfonamide diuretic drug, can block sodium reabsorption in distal tubules of the kidney and the cystic fibrosis transmembrane conductance regulator (CFTR) chloride channel. It is used for the treatment of oedema and hypertension.
| Trivial name | Diurexan |
| Catalog Number | CSN16162 |
| Alternative Name(s) | Diurexan |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C15H15ClN2O4S |
| CAS# | 14293-44-8 |
| Purity | ≥99% |
| SMILES | O=C(NC1=C(C)C=CC=C1C)C2=CC(S(=O)(N)=O)=C(Cl)C=C2O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/xipamide.html |
