GM6001
GM6001 is a broad spectrum MMPs inhibitor for MMP-1, MMP-2, MMP-3, MMP-7, MMP-8, MMP-9, MMP-12, MMP-14, and MMP-26 with Ki of 0.4 nM, 0.5 nM, 27 nM, 3.7 nM, 0.1 nM, 0.2 nM, 3.6 nM, 13.4 nM, 0.36 nM, respectively.
| Trivial name | Galardin; Ilomastat |
| Catalog Number | CSN11187 |
| Alternative Name(s) | Galardin; Ilomastat |
| Research Area | Cancer |
| Molecular Formula | C20H28N4O4 |
| CAS# | 142880-36-2 |
| Purity | ≥99% |
| SMILES | O=C(N[C@@H](CC1=CNC2=C1C=CC=C2)C(NC)=O)[C@H](CC(C)C)CC(NO)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/gm6001.html |
