(±)-Glycidyl-[d5] Oleate
(±)-Glycidyl-[d5] Oleate is an isotopically labelled analog of Glycidyl Oleate, which is used for preparation of Lysophosphatidic acid analogs as agonists of the edg2 lysophosphatidic acid receptor.
| Catalog Number | BLP-006888 |
| Alternative Name(s) | Glycidyl Oleate D5; (±)-Glycidyl 9(Z)-Octadecanoate-d5; (9Z)-9-Octadecenoic Acid 2-Oxiranylmethyl Ester-d5; Oleic Acid 2,3-Epoxypropyl Ester-d5; NSC 13542-d5; Oleic Acid Glycidyl Ester-d5 |
| Molecular Formula | C21H33D5O3 |
| CAS# | 1426395-63-2 |
| Purity | 98% |
| Inchi | InChI=1S/C21H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(22)24-19-20-18-23-20/h9-10,20H,2-8,11-19H2,1H3/b10-9-/i15D,16D2,17D2 |
| Inchi Key | VWYIWOYBERNXLX-LRHBODGVSA-N |
| Size | Please inquire |
| Supplier Page | https://isotope.bocsci.com/product/glycidyl-d5-oleate-cas-1426395-63-2-355091.html |
