Silodosin D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-P-00289 |
| Alternative Name(s) | (R)-1-(3-hydroxypropyl)-5-(2-((2-(2-(2,2,2-trifluoroethoxy)phenoxy)ethyl)amino)propyl)indoline-7-carboxamide D4. |
| Research Area | Labeled Silodosin, intended for use as an internal standard for the quantification of Silodosin by GC- or LC-mass spectrometry. |
| Molecular Formula | C25H28F3N3O4D4 |
| CAS# | 1426173-86-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OCCCN(CCC1=CC(C[C@@H](C)NC([2H])([2H])C([2H])([2H])OC(C=CC=C2)=C2OCC(F)(F)F)=C3)C1=C3C(N)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSP00289.html |
| Additional Information | NULL |