Neoponcirin
API Standards
| Trivial name | NULL |
| Catalog Number | CS-T-59226 |
| Alternative Name(s) | 5-hydroxy-2-(4-methoxyphenyl)-7-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-((((3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)methyl)tetrahydro-2H-pyran-2-yl)oxy)chroman-4-one |
| Research Area | Neoponcirin is a flavonoid that was shown to exhibit anticancer properties by inducing apoptosis by inhibiting N-Myc and upregulating RKIP in neuroblastoma. |
| Molecular Formula | C28H34O14 |
| CAS# | 14259-47-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C[C@@H](C1=CC=C(OC)C=C1)OC2=CC(O[C@@H]([C@@H]([C@@H](O)[C@@H]3O)O)O[C@@H]3CO[C@H](O[C@@H](C)[C@H](O)[C@H]4O)[C@@H]4O)=C5)C2=C5O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST59226.html |
| Additional Information | NULL |
