Zaragozic acid A | MedChemExpress (MCE)
Zaragozic acid A is a fungal metabolite that acts as a reversible competitive inhibitor of squalene synthase[1].
| Trivial name | Zaragozic acid A |
| Catalog Number | HY-116290 |
| Alternative Name(s) | Squalestatin S1 |
| Research Area | Others |
| CAS# | 142561-96-4 |
| Purity | ≥98.00% |
| SMILES | CC[C@@H](C[C@@H](/C=C/C(O[C@@H]1[C@H]([C@]2(O[C@@H]([C@@](C(O)=O)([C@]1(C(O)=O)O2)O)C(O)=O)CCC([C@H]([C@@H](CC3=CC=CC=C3)C)OC(C)=O)=C)O)=O)C)C |
| PubChem Chemical Structure ID | 6438355 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zaragozic-acid-a.html |