Flufenacet
Agro Chemicals
| Trivial name | NULL |
| Catalog Number | CS-T-54980 |
| Alternative Name(s) | N-(4-fluorophenyl)-N-isopropyl-2-((5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl)oxy)acetamide |
| Research Area | Flufenacet is an anilide based herbicide that is applied to the soil surface or incorporated before the crop is emerged. Flufenacet is often used in field corn, corn grown for silage or soybeans to control annual grasses and broadleaf weeds. |
| Molecular Formula | C14H13F4N3O2S |
| CAS# | 142459-58-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(COC1=NN=C(C(F)(F)F)S1)N(C2=CC=C(F)C=C2)C(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST54980.html |
| Additional Information | NULL |