Adefovir Dipivoxil
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30467 |
| Alternative Name(s) | ((((2-(6-amino-9H-purin-9-yl)ethoxy)methyl)phosphoryl)bis(oxy))bis(methylene) bis(2,2-dimethylpropanoate). |
| Research Area | Adefovir dipivoxil, previously called bis-POM PMEA, with trade names Preveon and Hepsera, is an orally-administered acyclic nucleotide analog reverse transcriptase inhibitor (ntRTI) used for treatment of hepatitis B.Adefovir dipivoxil is the diester prodr |
| Molecular Formula | C20H32N5O8P |
| CAS# | 142340-99-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[P](OCOC(C(C)(C)C)=O)(OCOC(C(C)(C)C)=O)COCCN1C(N=CN=C2N)=C2N=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30467.html |
| Additional Information | NULL |