Entecavir
Entecavir is a guanosine analogue that inhibits reverse transcription, DNA replication and transcription in the viral replication process, and is a potent, orally-active and selective inhibitor of HBV with an EC50 of 3.75 nM in HepG2 cell.
| Trivial name | BMS200475 |
| Catalog Number | CSN10911 |
| Alternative Name(s) | BMS200475 |
| Research Area | Infection |
| Molecular Formula | C12H15N5O3 |
| CAS# | 142217-69-4 |
| Purity | ≥98% |
| SMILES | O=C1NC(N)=NC2=C1N=CN2[C@@H]3C([C@H](CO)[C@@H](O)C3)=C |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/entecavir.html |