Osimertinib
Osimertinib is a Kinase Inhibitor. The mechanism of action of osimertinib is as a Kinase Inhibitor, and Cytochrome P450 3A Inhibitor, and Cytochrome P450 3A4 Inducer, and Cytochrome P450 1A2 Inducer, and Breast Cancer Resistance Protein Inhibitor.
| Catalog Number | API1421373650 |
| Alternative Name(s) | AZD-9291 Mereletinib AZD9291 |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C28H33N7O2 |
| CAS# | 1421373-65-0 |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=NC(=NC=C3)NC4=C(C=C(C(=C4)NC(=O)C=C)N(C)CCN(C)C)OC |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/osimertinib-item-12194.html |