Olmesartan D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06829 |
| Alternative Name(s) | 4-(1-Hydroxy-1-methylethyl)-2-propyl-1-[[2’-(1H-tetazol-5-yl)[1,1’-biphenyl]-4-yl]methyl]-1H-imidazole-5-carboxylic Acid-d4; CS 088-d4; RNH 6270-d4; |
| Research Area | Labeled Olmesartan, intended for use as an internal standard for the quantification of Olmesartan by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H22N6O3D4 |
| CAS# | 1420880-41-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=C(C(C)(O)C)N=C(CCC)N1CC(C([2H])=C2[2H])=C(C([2H])=C2C3=C(C4=NN=NN4)C=CC=C3)[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06829.html |
| Additional Information | NULL |
