Bioymifi 2mg
Bioymifi is a potent and selective small molecule agonist of DR5 that directly targets DR5, specifically binds the ECD of DR5 (Kd ~1.2 ??M), and induces the formation of DR5 aggregates and DR5 activation.
| Trivial name | Bioymifi 2mg |
| Catalog Number | A12908-2 |
| Alternative Name(s) | (Z)-5-(5-((3-(4-bromophenyl)-2-imino-4-oxothiazolidin-5-ylidene)methyl)furan-2-yl)isoindoline-1,3-dione |
| Molecular Formula | C22H12BrN3O4S |
| CAS# | 1420071-30-2 |
| SMILES | C1=CC(=CC=C1N2C(=O)/C(=C/C3=CC=C(O3)C4=CC5=C(C=C4)C(=O)NC5=O)/SC2=N)Br |
| Size | 2mg |
| Supplier Page | http://www.adooq.com/bioymifi.html |
