LAS191859 | MedChemExpress (MCE)
LAS191859 is an orally active, potent and selective CRTh2 antagonist with an IC50 of 9.58 nM against human CRTh2. LAS191859 can be used for the research of chronic asthma[1].
| Trivial name | LAS191859 |
| Catalog Number | HY-123596 |
| Research Area | Inflammation/Immunology |
| CAS# | 1420071-13-1 |
| Purity | ≥98.00% |
| SMILES | CCN(CC1=CC(C(F)(F)F)=CC=C1N2C=C(C3=C2N=C(C=C3)C)CC(O)=O)C(C4CC4)=O |
| PubChem Chemical Structure ID | 71222485 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/las191859.html |