Niclosamide olamine
Niclosamide olamine is an anthelmintic that disrupts mitochondrial metabolism in parasitic worms and animal models. Niclosamide olamine inhibits STAT3 (IC50 = 0.25 μM) and stimulates autophagy by reversibly inhibiting mammalian target of Rapamycin complex 1 (mTORC1) signaling.
| Trivial name | BAY2353 olamine |
| Catalog Number | CSN27361 |
| Alternative Name(s) | BAY2353 olamine |
| Research Area | / |
| Molecular Formula | C15H15Cl2N3O5 |
| CAS# | 1420-04-8 |
| Purity | ≥98% |
| SMILES | O=C(NC1=CC=C([N+]([O-])=O)C=C1Cl)C2=CC(Cl)=CC=C2O.NCCO |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/5-chloro-n-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide-2-aminoethanol-salt.html |